C16H22ClN3O2 — CID 108566693
3-chloro-2,2-dimethyl-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide (PubChem CID 108566693) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108566693 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]propanamide |
| SMILES | CC(C)(CCl)C(=O)NC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-16(2,11-17)15(22)19-13-5-9-20(10-6-13)14(21)12-3-7-18-8-4-12/h3-4,7-8,13H,5-6,9-11H2,1-2H3,(H,19,22) |
| InChIKey | XPMVQDHWNKTTGJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|