C12H22ClN3O2 — CID 63680196
N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide (PubChem CID 63680196) has the molecular formula C12H22ClN3O2 and a molecular weight of 275.78 g/mol. Its IUPAC name is N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63680196 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C12H22ClN3O2/c1-12(2,8-13)11(18)15-9-3-5-16(6-4-9)7-10(14)17/h9H,3-8H2,1-2H3,(H2,14,17)(H,15,18) |
| InChIKey | ZYJDPBUJAYLVNX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|