C14H28O3 — CID 70398525
7-cyclohexyl-2-methylheptane-1,4,5-triol (PubChem CID 70398525) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 7-cyclohexyl-2-methylheptane-1,4,5-triol.
| Compound Name | 7-cyclohexyl-2-methylheptane-1,4,5-triol |
|---|---|
| PubChem CID | 70398525 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 7-cyclohexyl-2-methylheptane-1,4,5-triol |
| SMILES | CC(CO)CC(O)C(O)CCC1CCCCC1 |
| InChI | InChI=1S/C14H28O3/c1-11(10-15)9-14(17)13(16)8-7-12-5-3-2-4-6-12/h11-17H,2-10H2,1H3 |
| InChIKey | PJDRTSJOUGCSAY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |