C13H26O4 — CID 71150966
8-cyclobutyl-5-methyloctane-1,2,3,4-tetrol (PubChem CID 71150966) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 8-cyclobutyl-5-methyloctane-1,2,3,4-tetrol.
| Compound Name | 8-cyclobutyl-5-methyloctane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 71150966 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 8-cyclobutyl-5-methyloctane-1,2,3,4-tetrol |
| SMILES | CC(CCCC1CCC1)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C13H26O4/c1-9(4-2-5-10-6-3-7-10)12(16)13(17)11(15)8-14/h9-17H,2-8H2,1H3 |
| InChIKey | ZGZRAPADMIPTDJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |