C16H34N2O3Si — CID 57462032
2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate (PubChem CID 57462032) has the molecular formula C16H34N2O3Si and a molecular weight of 330.55 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 57462032 |
| Molecular Formula | C16H34N2O3Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NC[C@@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C16H34N2O3Si/c1-22(2,3)10-9-21-16(20)18-12-15(19)14(17)11-13-7-5-4-6-8-13/h13-15,19H,4-12,17H2,1-3H3,(H,18,20)/t14-,15+/m0/s1 |
| InChIKey | BJVFYWNZJNAYPT-LSDHHAIUSA-N |
| XLogP | 2.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|