C15H34N2OSi — CID 68711280
(2S)-3-cyclohexyl-1-N-(2-trimethylsilylethoxymethyl)propane-1,2-diamine (PubChem CID 68711280) has the molecular formula C15H34N2OSi and a molecular weight of 286.54 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-1-N-(2-trimethylsilylethoxymethyl)propane-1,2-diamine.
| Compound Name | (2S)-3-cyclohexyl-1-N-(2-trimethylsilylethoxymethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 68711280 |
| Molecular Formula | C15H34N2OSi |
| Molecular Weight | 286.54 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (2S)-3-cyclohexyl-1-N-(2-trimethylsilylethoxymethyl)propane-1,2-diamine |
| SMILES | C[Si](C)(C)CCOCNC[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C15H34N2OSi/c1-19(2,3)10-9-18-13-17-12-15(16)11-14-7-5-4-6-8-14/h14-15,17H,4-13,16H2,1-3H3/t15-/m0/s1 |
| InChIKey | GGYOBHOJWQTBCI-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|