C18H38N2O2Si — CID 67190569
2-trimethylsilylethyl N-[(2S)-2-amino-3-cyclohexylpropyl]-N-propylcarbamate (PubChem CID 67190569) has the molecular formula C18H38N2O2Si and a molecular weight of 342.60 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2S)-2-amino-3-cyclohexylpropyl]-N-propylcarbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2S)-2-amino-3-cyclohexylpropyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 67190569 |
| Molecular Formula | C18H38N2O2Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2S)-2-amino-3-cyclohexylpropyl]-N-propylcarbamate |
| SMILES | CCCN(C[C@@H](N)CC1CCCCC1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H38N2O2Si/c1-5-11-20(18(21)22-12-13-23(2,3)4)15-17(19)14-16-9-7-6-8-10-16/h16-17H,5-15,19H2,1-4H3/t17-/m0/s1 |
| InChIKey | ONMXDTOQJOKKSE-KRWDZBQOSA-N |
| XLogP | 4.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|