C25H44N2O6SSi — CID 123345621
4-methylbenzenesulfonic acid;2-trimethylsilylethyl N-(2-amino-2-oxoethyl)-N-[(2S)-3-cyclohexyl-2-methylpropyl]carbamate (PubChem CID 123345621) has the molecular formula C25H44N2O6SSi and a molecular weight of 528.79 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-trimethylsilylethyl N-(2-amino-2-oxoethyl)-N-[(2S)-3-cyclohexyl-2-methylpropyl]carbamate.
| Compound Name | 4-methylbenzenesulfonic acid;2-trimethylsilylethyl N-(2-amino-2-oxoethyl)-N-[(2S)-3-cyclohexyl-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 123345621 |
| Molecular Formula | C25H44N2O6SSi |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-trimethylsilylethyl N-(2-amino-2-oxoethyl)-N-[(2S)-3-cyclohexyl-2-methylpropyl]carbamate |
| SMILES | C[C@@H](CC1CCCCC1)CN(CC(N)=O)C(=O)OCC[Si](C)(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H36N2O3Si.C7H8O3S/c1-15(12-16-8-6-5-7-9-16)13-20(14-17(19)21)18(22)23-10-11-24(2,3)4;1-6-2-4-7(5-3-6)11(8,9)10/h15-16H,5-14H2,1-4H3,(H2,19,21);2-5H,1H3,(H,8,9,10)/t15-;/m0./s1 |
| InChIKey | BRSKPTZPXCBDMY-RSAXXLAASA-N |
| XLogP | 5.10 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|