C14H21NO5S2 — CID 176508725
(E,1R)-1-cyclopropyl-3-methylsulfonylprop-2-en-1-amine;4-methylbenzenesulfonic acid (PubChem CID 176508725) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (E,1R)-1-cyclopropyl-3-methylsulfonylprop-2-en-1-amine;4-methylbenzenesulfonic acid.
| Compound Name | (E,1R)-1-cyclopropyl-3-methylsulfonylprop-2-en-1-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 176508725 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E,1R)-1-cyclopropyl-3-methylsulfonylprop-2-en-1-amine;4-methylbenzenesulfonic acid |
| SMILES | CS(=O)(=O)/C=C/[C@H](N)C1CC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H13NO2S.C7H8O3S/c1-11(9,10)5-4-7(8)6-2-3-6;1-6-2-4-7(5-3-6)11(8,9)10/h4-7H,2-3,8H2,1H3;2-5H,1H3,(H,8,9,10)/b5-4+;/t7-;/m0./s1 |
| InChIKey | CSUDAQBJWCKSCU-NPNPHVFISA-N |
| XLogP | 1.52 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|