C22H43N3O5Si — CID 67189677
tert-butyl (3S)-2-amino-3-[(2-amino-2-oxoethyl)-(2-trimethylsilylethoxycarbonyl)amino]-4-cyclohexylbutanoate (PubChem CID 67189677) has the molecular formula C22H43N3O5Si and a molecular weight of 457.69 g/mol. Its IUPAC name is tert-butyl (3S)-2-amino-3-[(2-amino-2-oxoethyl)-(2-trimethylsilylethoxycarbonyl)amino]-4-cyclohexylbutanoate.
| Compound Name | tert-butyl (3S)-2-amino-3-[(2-amino-2-oxoethyl)-(2-trimethylsilylethoxycarbonyl)amino]-4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 67189677 |
| Molecular Formula | C22H43N3O5Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | tert-butyl (3S)-2-amino-3-[(2-amino-2-oxoethyl)-(2-trimethylsilylethoxycarbonyl)amino]-4-cyclohexylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(N)[C@H](CC1CCCCC1)N(CC(N)=O)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C22H43N3O5Si/c1-22(2,3)30-20(27)19(24)17(14-16-10-8-7-9-11-16)25(15-18(23)26)21(28)29-12-13-31(4,5)6/h16-17,19H,7-15,24H2,1-6H3,(H2,23,26)/t17-,19?/m0/s1 |
| InChIKey | IJSRHAKRMMSSHY-KKFHFHRHSA-N |
| XLogP | 3.26 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|