C16H30N2O5 — CID 67937284
tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3,4-dihydroxy-5-oxopentanoate (PubChem CID 67937284) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3,4-dihydroxy-5-oxopentanoate.
| Compound Name | tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3,4-dihydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 67937284 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3,4-dihydroxy-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)C(CC1CCCCC1)C(O)C(N)(O)C(N)=O |
| InChI | InChI=1S/C16H30N2O5/c1-15(2,3)23-13(20)11(9-10-7-5-4-6-8-10)12(19)16(18,22)14(17)21/h10-12,19,22H,4-9,18H2,1-3H3,(H2,17,21) |
| InChIKey | FEZSTVQHZJHXPO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|