C19H39NO4Si — CID 90274253
tert-butyl N-[1-cyclobutyl-3-(3-trimethylsilylpropoxymethoxy)propan-2-yl]carbamate (PubChem CID 90274253) has the molecular formula C19H39NO4Si and a molecular weight of 373.61 g/mol. Its IUPAC name is tert-butyl N-[1-cyclobutyl-3-(3-trimethylsilylpropoxymethoxy)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-cyclobutyl-3-(3-trimethylsilylpropoxymethoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90274253 |
| Molecular Formula | C19H39NO4Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | tert-butyl N-[1-cyclobutyl-3-(3-trimethylsilylpropoxymethoxy)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(COCOCCC[Si](C)(C)C)CC1CCC1 |
| InChI | InChI=1S/C19H39NO4Si/c1-19(2,3)24-18(21)20-17(13-16-9-7-10-16)14-23-15-22-11-8-12-25(4,5)6/h16-17H,7-15H2,1-6H3,(H,20,21) |
| InChIKey | OVYYPOCLDASMEQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|