C26H43N3O5Si — CID 86626202
2-trimethylsilylethyl N-[(2S)-3-cyclohexyl-2-[[3-[methoxy(methyl)carbamoyl]benzoyl]amino]propyl]-N-methylcarbamate (PubChem CID 86626202) has the molecular formula C26H43N3O5Si and a molecular weight of 505.73 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2S)-3-cyclohexyl-2-[[3-[methoxy(methyl)carbamoyl]benzoyl]amino]propyl]-N-methylcarbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2S)-3-cyclohexyl-2-[[3-[methoxy(methyl)carbamoyl]benzoyl]amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86626202 |
| Molecular Formula | C26H43N3O5Si |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2S)-3-cyclohexyl-2-[[3-[methoxy(methyl)carbamoyl]benzoyl]amino]propyl]-N-methylcarbamate |
| SMILES | CON(C)C(=O)c1cccc(C(=O)N[C@@H](CC2CCCCC2)CN(C)C(=O)OCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C26H43N3O5Si/c1-28(26(32)34-15-16-35(4,5)6)19-23(17-20-11-8-7-9-12-20)27-24(30)21-13-10-14-22(18-21)25(31)29(2)33-3/h10,13-14,18,20,23H,7-9,11-12,15-17,19H2,1-6H3,(H,27,30)/t23-/m0/s1 |
| InChIKey | WUGVMDSCEIMWGR-QHCPKHFHSA-N |
| XLogP | 4.80 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|