C29H47IN2O5Si — CID 69467143
2-trimethylsilylethyl N-[3-(1-iodocyclohexyl)-2-[[3-(5-methoxypentanoyl)benzoyl]amino]propyl]-N-methylcarbamate (PubChem CID 69467143) has the molecular formula C29H47IN2O5Si and a molecular weight of 658.69 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[3-(1-iodocyclohexyl)-2-[[3-(5-methoxypentanoyl)benzoyl]amino]propyl]-N-methylcarbamate.
| Compound Name | 2-trimethylsilylethyl N-[3-(1-iodocyclohexyl)-2-[[3-(5-methoxypentanoyl)benzoyl]amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 69467143 |
| Molecular Formula | C29H47IN2O5Si |
| Molecular Weight | 658.69 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 2-trimethylsilylethyl N-[3-(1-iodocyclohexyl)-2-[[3-(5-methoxypentanoyl)benzoyl]amino]propyl]-N-methylcarbamate |
| SMILES | COCCCCC(=O)c1cccc(C(=O)NC(CN(C)C(=O)OCC[Si](C)(C)C)CC2(I)CCCCC2)c1 |
| InChI | InChI=1S/C29H47IN2O5Si/c1-32(28(35)37-18-19-38(3,4)5)22-25(21-29(30)15-8-6-9-16-29)31-27(34)24-13-11-12-23(20-24)26(33)14-7-10-17-36-2/h11-13,20,25H,6-10,14-19,21-22H2,1-5H3,(H,31,34) |
| InChIKey | WFXCUGTXXDOBCY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|