C24H38N2O4Si — CID 87550769
[2-[(3-formylbenzoyl)amino]-3-[3-(2-trimethylsilylethyl)cyclohexyl]propyl]-methylcarbamic acid (PubChem CID 87550769) has the molecular formula C24H38N2O4Si and a molecular weight of 446.66 g/mol. Its IUPAC name is [2-[(3-formylbenzoyl)amino]-3-[3-(2-trimethylsilylethyl)cyclohexyl]propyl]-methylcarbamic acid.
| Compound Name | [2-[(3-formylbenzoyl)amino]-3-[3-(2-trimethylsilylethyl)cyclohexyl]propyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87550769 |
| Molecular Formula | C24H38N2O4Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | [2-[(3-formylbenzoyl)amino]-3-[3-(2-trimethylsilylethyl)cyclohexyl]propyl]-methylcarbamic acid |
| SMILES | CN(CC(CC1CCCC(CC[Si](C)(C)C)C1)NC(=O)c1cccc(C=O)c1)C(=O)O |
| InChI | InChI=1S/C24H38N2O4Si/c1-26(24(29)30)16-22(25-23(28)21-10-6-9-20(14-21)17-27)15-19-8-5-7-18(13-19)11-12-31(2,3)4/h6,9-10,14,17-19,22H,5,7-8,11-13,15-16H2,1-4H3,(H,25,28)(H,29,30) |
| InChIKey | WMVVLBQOBSJRFS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|