C13H18INO3Si — CID 69472359
(2S)-2-[(3-iodobenzoyl)amino]-3-trimethylsilylpropanoic acid (PubChem CID 69472359) has the molecular formula C13H18INO3Si and a molecular weight of 391.28 g/mol. Its IUPAC name is (2S)-2-[(3-iodobenzoyl)amino]-3-trimethylsilylpropanoic acid.
| Compound Name | (2S)-2-[(3-iodobenzoyl)amino]-3-trimethylsilylpropanoic acid |
|---|---|
| PubChem CID | 69472359 |
| Molecular Formula | C13H18INO3Si |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (2S)-2-[(3-iodobenzoyl)amino]-3-trimethylsilylpropanoic acid |
| SMILES | C[Si](C)(C)C[C@@H](NC(=O)c1cccc(I)c1)C(=O)O |
| InChI | InChI=1S/C13H18INO3Si/c1-19(2,3)8-11(13(17)18)15-12(16)9-5-4-6-10(14)7-9/h4-7,11H,8H2,1-3H3,(H,15,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | CEYZKIIXPZFDAE-LLVKDONJSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|