C25H36N2O4 — CID 68708237
[(2S)-2-[(3-benzoylcyclohexanecarbonyl)amino]-3-cyclohexylpropyl]-methylcarbamic acid (PubChem CID 68708237) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(2S)-2-[(3-benzoylcyclohexanecarbonyl)amino]-3-cyclohexylpropyl]-methylcarbamic acid.
| Compound Name | [(2S)-2-[(3-benzoylcyclohexanecarbonyl)amino]-3-cyclohexylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68708237 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [(2S)-2-[(3-benzoylcyclohexanecarbonyl)amino]-3-cyclohexylpropyl]-methylcarbamic acid |
| SMILES | CN(C[C@H](CC1CCCCC1)NC(=O)C1CCCC(C(=O)c2ccccc2)C1)C(=O)O |
| InChI | InChI=1S/C25H36N2O4/c1-27(25(30)31)17-22(15-18-9-4-2-5-10-18)26-24(29)21-14-8-13-20(16-21)23(28)19-11-6-3-7-12-19/h3,6-7,11-12,18,20-22H,2,4-5,8-10,13-17H2,1H3,(H,26,29)(H,30,31)/t20?,21?,22-/m0/s1 |
| InChIKey | JKSOQGKJXGPSDS-HRTMPFAESA-N |
| XLogP | 4.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |