C25H36N2O4 — CID 68709877
[(3-benzoylcyclohexanecarbonyl)amino]-(4-cyclohexylbutyl)carbamic acid (PubChem CID 68709877) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(3-benzoylcyclohexanecarbonyl)amino]-(4-cyclohexylbutyl)carbamic acid.
| Compound Name | [(3-benzoylcyclohexanecarbonyl)amino]-(4-cyclohexylbutyl)carbamic acid |
|---|---|
| PubChem CID | 68709877 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [(3-benzoylcyclohexanecarbonyl)amino]-(4-cyclohexylbutyl)carbamic acid |
| SMILES | O=C(NN(CCCCC1CCCCC1)C(=O)O)C1CCCC(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H36N2O4/c28-23(20-13-5-2-6-14-20)21-15-9-16-22(18-21)24(29)26-27(25(30)31)17-8-7-12-19-10-3-1-4-11-19/h2,5-6,13-14,19,21-22H,1,3-4,7-12,15-18H2,(H,26,29)(H,30,31) |
| InChIKey | KAVHNYVCDQYABV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|