C17H24N2O3 — CID 91059874
methyl (2R)-2-[(3-aminobenzoyl)amino]-3-cyclohexylpropanoate (PubChem CID 91059874) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl (2R)-2-[(3-aminobenzoyl)amino]-3-cyclohexylpropanoate.
| Compound Name | methyl (2R)-2-[(3-aminobenzoyl)amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 91059874 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | methyl (2R)-2-[(3-aminobenzoyl)amino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)[C@@H](CC1CCCCC1)NC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-22-17(21)15(10-12-6-3-2-4-7-12)19-16(20)13-8-5-9-14(18)11-13/h5,8-9,11-12,15H,2-4,6-7,10,18H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | GCDYUIIHUKUJQK-OAHLLOKOSA-N |
| XLogP | 2.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|