C27H30N2O3 — CID 20624069
methyl 2-[(4-amino-2-naphthalen-1-ylbenzoyl)amino]-3-cyclohexylpropanoate (PubChem CID 20624069) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is methyl 2-[(4-amino-2-naphthalen-1-ylbenzoyl)amino]-3-cyclohexylpropanoate.
| Compound Name | methyl 2-[(4-amino-2-naphthalen-1-ylbenzoyl)amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 20624069 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | methyl 2-[(4-amino-2-naphthalen-1-ylbenzoyl)amino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)C(CC1CCCCC1)NC(=O)c1ccc(N)cc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C27H30N2O3/c1-32-27(31)25(16-18-8-3-2-4-9-18)29-26(30)23-15-14-20(28)17-24(23)22-13-7-11-19-10-5-6-12-21(19)22/h5-7,10-15,17-18,25H,2-4,8-9,16,28H2,1H3,(H,29,30) |
| InChIKey | HRKRHAOYJAJKEU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|