C24H30NO6P — CID 23734342
3-[benzoyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-cyclohexylpropanoic acid (PubChem CID 23734342) has the molecular formula C24H30NO6P and a molecular weight of 459.48 g/mol. Its IUPAC name is 3-[benzoyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-cyclohexylpropanoic acid.
| Compound Name | 3-[benzoyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 23734342 |
| Molecular Formula | C24H30NO6P |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[benzoyl-[[4-(phosphonomethyl)phenyl]methyl]amino]-3-cyclohexylpropanoic acid |
| SMILES | O=C(O)CC(C1CCCCC1)N(Cc1ccc(CP(=O)(O)O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30NO6P/c26-23(27)15-22(20-7-3-1-4-8-20)25(24(28)21-9-5-2-6-10-21)16-18-11-13-19(14-12-18)17-32(29,30)31/h2,5-6,9-14,20,22H,1,3-4,7-8,15-17H2,(H,26,27)(H2,29,30,31) |
| InChIKey | RZFOMVBCMDYXIH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|