C20H27NO — CID 118530454
N,N-dimethyl-5-(4-methylphenoxy)-5-phenylpentan-1-amine (PubChem CID 118530454) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-methylphenoxy)-5-phenylpentan-1-amine.
| Compound Name | N,N-dimethyl-5-(4-methylphenoxy)-5-phenylpentan-1-amine |
|---|---|
| PubChem CID | 118530454 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N,N-dimethyl-5-(4-methylphenoxy)-5-phenylpentan-1-amine |
| SMILES | Cc1ccc(OC(CCCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-17-12-14-19(15-13-17)22-20(11-7-8-16-21(2)3)18-9-5-4-6-10-18/h4-6,9-10,12-15,20H,7-8,11,16H2,1-3H3 |
| InChIKey | HNKWQPVWDLCSFV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|