C19H25NO — CID 117067240
N,N-diethyl-2-(4-methylphenoxy)-2-phenylethanamine (PubChem CID 117067240) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N,N-diethyl-2-(4-methylphenoxy)-2-phenylethanamine.
| Compound Name | N,N-diethyl-2-(4-methylphenoxy)-2-phenylethanamine |
|---|---|
| PubChem CID | 117067240 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N,N-diethyl-2-(4-methylphenoxy)-2-phenylethanamine |
| SMILES | CCN(CC)CC(Oc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO/c1-4-20(5-2)15-19(17-9-7-6-8-10-17)21-18-13-11-16(3)12-14-18/h6-14,19H,4-5,15H2,1-3H3 |
| InChIKey | FTSUJPBVSJDCLD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |