About [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride
[2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride (PubChem CID 131700838) has the molecular formula C20H26ClNO3
and a molecular weight of 363.89 g/mol. Its IUPAC name is [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride.
Molecular Properties
| Compound Name | [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride |
| PubChem CID | 131700838 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride |
| SMILES | CCN(CC)CC(OC(=O)COc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H25NO3.ClH/c1-3-21(4-2)15-19(17-11-7-5-8-12-17)24-20(22)16-23-18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H |
| InChIKey | MWHAVBLZLGSQAC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride?
The IUPAC name of [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride (CID 131700838) is [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride.
What is the SMILES notation for [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride?
The canonical SMILES for [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride is CCN(CC)CC(OC(=O)COc1ccccc1)c1ccccc1.Cl.
What is the InChIKey of [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride?
The InChIKey is MWHAVBLZLGSQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3.ClH/c1-3-21(4-2)15-19(17-11-7-5-8-12-17)24-20(22)16-23-18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H.
What are the key properties of [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride?
[2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride has a molecular weight of 363.89 g/mol, XLogP of 4.11, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethylamino)-1-phenylethyl] 2-phenoxyacetate;hydrochloride is sourced from PubChem (CID 131700838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).