C14H24N2 — CID 103993772
N',N'-dimethyl-N-[(1S)-1-(3-methylphenyl)ethyl]propane-1,3-diamine (PubChem CID 103993772) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(1S)-1-(3-methylphenyl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[(1S)-1-(3-methylphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103993772 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N',N'-dimethyl-N-[(1S)-1-(3-methylphenyl)ethyl]propane-1,3-diamine |
| SMILES | Cc1cccc([C@H](C)NCCCN(C)C)c1 |
| InChI | InChI=1S/C14H24N2/c1-12-7-5-8-14(11-12)13(2)15-9-6-10-16(3)4/h5,7-8,11,13,15H,6,9-10H2,1-4H3/t13-/m0/s1 |
| InChIKey | PGSILYPFORFQFE-ZDUSSCGKSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|