C25H37NO3S — CID 173333887
N,N-dimethyl-9-phenylnonan-1-amine;2-phenylethenesulfonic acid (PubChem CID 173333887) has the molecular formula C25H37NO3S and a molecular weight of 431.64 g/mol. Its IUPAC name is N,N-dimethyl-9-phenylnonan-1-amine;2-phenylethenesulfonic acid.
| Compound Name | N,N-dimethyl-9-phenylnonan-1-amine;2-phenylethenesulfonic acid |
|---|---|
| PubChem CID | 173333887 |
| Molecular Formula | C25H37NO3S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | N,N-dimethyl-9-phenylnonan-1-amine;2-phenylethenesulfonic acid |
| SMILES | CN(C)CCCCCCCCCc1ccccc1.O=S(=O)(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H29N.C8H8O3S/c1-18(2)16-12-7-5-3-4-6-9-13-17-14-10-8-11-15-17;9-12(10,11)7-6-8-4-2-1-3-5-8/h8,10-11,14-15H,3-7,9,12-13,16H2,1-2H3;1-7H,(H,9,10,11) |
| InChIKey | CWADHCVBLDPPBO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|