About hydride;2-phenylethenesulfonic acid;rubidium(1+)
hydride;2-phenylethenesulfonic acid;rubidium(1+) (PubChem CID 173085855) has the molecular formula C8H9O3RbS
and a molecular weight of 270.69 g/mol. Its IUPAC name is hydride;2-phenylethenesulfonic acid;rubidium(1+).
Molecular Properties
| Compound Name | hydride;2-phenylethenesulfonic acid;rubidium(1+) |
| PubChem CID | 173085855 |
| Molecular Formula | C8H9O3RbS |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | hydride;2-phenylethenesulfonic acid;rubidium(1+) |
| SMILES | O=S(=O)(O)C=Cc1ccccc1.[H-].[Rb+] |
| InChI | InChI=1S/C8H8O3S.Rb.H/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H,9,10,11);;/q;+1;-1 |
| InChIKey | DAVYXLCFCUCXJS-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydride;2-phenylethenesulfonic acid;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;2-phenylethenesulfonic acid;rubidium(1+)?
The IUPAC name of hydride;2-phenylethenesulfonic acid;rubidium(1+) (CID 173085855) is hydride;2-phenylethenesulfonic acid;rubidium(1+).
What is the SMILES notation for hydride;2-phenylethenesulfonic acid;rubidium(1+)?
The canonical SMILES for hydride;2-phenylethenesulfonic acid;rubidium(1+) is O=S(=O)(O)C=Cc1ccccc1.[H-].[Rb+].
What is the InChIKey of hydride;2-phenylethenesulfonic acid;rubidium(1+)?
The InChIKey is DAVYXLCFCUCXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S.Rb.H/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H,9,10,11);;/q;+1;-1.
What are the key properties of hydride;2-phenylethenesulfonic acid;rubidium(1+)?
hydride;2-phenylethenesulfonic acid;rubidium(1+) has a molecular weight of 270.69 g/mol, XLogP of -1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;2-phenylethenesulfonic acid;rubidium(1+) is sourced from PubChem (CID 173085855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).