C10H11KO6S2 — CID 172779366
potassium;ethenesulfonic acid;2-phenylethenesulfonate (PubChem CID 172779366) has the molecular formula C10H11KO6S2 and a molecular weight of 330.42 g/mol. Its IUPAC name is potassium;ethenesulfonic acid;2-phenylethenesulfonate.
| Compound Name | potassium;ethenesulfonic acid;2-phenylethenesulfonate |
|---|---|
| PubChem CID | 172779366 |
| Molecular Formula | C10H11KO6S2 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | potassium;ethenesulfonic acid;2-phenylethenesulfonate |
| SMILES | C=CS(=O)(=O)O.O=S(=O)([O-])C=Cc1ccccc1.[K+] |
| InChI | InChI=1S/C8H8O3S.C2H4O3S.K/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-2-6(3,4)5;/h1-7H,(H,9,10,11);2H,1H2,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | OAVVYJCDFBPZBK-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|