C12H13NaO5S — CID 159801460
sodium;ethenyl acetate;2-phenylethenesulfonate (PubChem CID 159801460) has the molecular formula C12H13NaO5S and a molecular weight of 292.29 g/mol. Its IUPAC name is sodium;ethenyl acetate;2-phenylethenesulfonate.
| Compound Name | sodium;ethenyl acetate;2-phenylethenesulfonate |
|---|---|
| PubChem CID | 159801460 |
| Molecular Formula | C12H13NaO5S |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | sodium;ethenyl acetate;2-phenylethenesulfonate |
| SMILES | C=COC(C)=O.O=S(=O)([O-])C=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O3S.C4H6O2.Na/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-3-6-4(2)5;/h1-7H,(H,9,10,11);3H,1H2,2H3;/q;;+1/p-1 |
| InChIKey | NJVQAYMAYITJKZ-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|