C15H18NNaO5S — CID 173393289
sodium;2-aminoprop-2-enyl 2-methylprop-2-enoate;2-phenylethenesulfonate (PubChem CID 173393289) has the molecular formula C15H18NNaO5S and a molecular weight of 347.37 g/mol. Its IUPAC name is sodium;2-aminoprop-2-enyl 2-methylprop-2-enoate;2-phenylethenesulfonate.
| Compound Name | sodium;2-aminoprop-2-enyl 2-methylprop-2-enoate;2-phenylethenesulfonate |
|---|---|
| PubChem CID | 173393289 |
| Molecular Formula | C15H18NNaO5S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | sodium;2-aminoprop-2-enyl 2-methylprop-2-enoate;2-phenylethenesulfonate |
| SMILES | C=C(N)COC(=O)C(=C)C.O=S(=O)([O-])C=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O3S.C7H11NO2.Na/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-5(2)7(9)10-4-6(3)8;/h1-7H,(H,9,10,11);1,3-4,8H2,2H3;/q;;+1/p-1 |
| InChIKey | XXGIWDJFNPSWBH-UHFFFAOYSA-M |
| XLogP | -1.22 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|