C14H16O8S2 — CID 57262237
2-[4-[2-(2-methylprop-2-enoyloxy)ethoxysulfonyl]phenyl]ethenesulfonic acid (PubChem CID 57262237) has the molecular formula C14H16O8S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[4-[2-(2-methylprop-2-enoyloxy)ethoxysulfonyl]phenyl]ethenesulfonic acid.
| Compound Name | 2-[4-[2-(2-methylprop-2-enoyloxy)ethoxysulfonyl]phenyl]ethenesulfonic acid |
|---|---|
| PubChem CID | 57262237 |
| Molecular Formula | C14H16O8S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[4-[2-(2-methylprop-2-enoyloxy)ethoxysulfonyl]phenyl]ethenesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOS(=O)(=O)c1ccc(C=CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H16O8S2/c1-11(2)14(15)21-8-9-22-24(19,20)13-5-3-12(4-6-13)7-10-23(16,17)18/h3-7,10H,1,8-9H2,2H3,(H,16,17,18) |
| InChIKey | OJDSRNZFHQLSLG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|