C14H17NaO6S — CID 86722558
sodium;2-hydroxyethyl 2-methylprop-2-enoate;2-phenylethenesulfonate (PubChem CID 86722558) has the molecular formula C14H17NaO6S and a molecular weight of 336.34 g/mol. Its IUPAC name is sodium;2-hydroxyethyl 2-methylprop-2-enoate;2-phenylethenesulfonate.
| Compound Name | sodium;2-hydroxyethyl 2-methylprop-2-enoate;2-phenylethenesulfonate |
|---|---|
| PubChem CID | 86722558 |
| Molecular Formula | C14H17NaO6S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | sodium;2-hydroxyethyl 2-methylprop-2-enoate;2-phenylethenesulfonate |
| SMILES | C=C(C)C(=O)OCCO.O=S(=O)([O-])C=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O3S.C6H10O3.Na/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-5(2)6(8)9-4-3-7;/h1-7H,(H,9,10,11);7H,1,3-4H2,2H3;/q;;+1/p-1 |
| InChIKey | WVNOXCLUDOCQBH-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|