C21H28O5 — CID 88665483
butyl 2-methylidene-4-phenylbut-3-enoate;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 88665483) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is butyl 2-methylidene-4-phenylbut-3-enoate;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylidene-4-phenylbut-3-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88665483 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | butyl 2-methylidene-4-phenylbut-3-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=C(C=Cc1ccccc1)C(=O)OCCCC |
| InChI | InChI=1S/C15H18O2.C6H10O3/c1-3-4-12-17-15(16)13(2)10-11-14-8-6-5-7-9-14;1-5(2)6(8)9-4-3-7/h5-11H,2-4,12H2,1H3;7H,1,3-4H2,2H3 |
| InChIKey | IMPQPTPBGTWHHY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|