C28H40O7 — CID 88689251
butan-2-yl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 88689251) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is butan-2-yl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | butan-2-yl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88689251 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | butan-2-yl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=C(C=Cc1ccccc1)C(=O)OC(C)CC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C15H18O2.C7H12O2.C6H10O3/c1-4-13(3)17-15(16)12(2)10-11-14-8-6-5-7-9-14;1-3-5-6-9-7(8)4-2;1-5(2)6(8)9-4-3-7/h5-11,13H,2,4H2,1,3H3;4H,2-3,5-6H2,1H3;7H,1,3-4H2,2H3 |
| InChIKey | RZJGQWMNBCAPIO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|