C27H38O7 — CID 87950372
tert-butyl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate (PubChem CID 87950372) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is tert-butyl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate.
| Compound Name | tert-butyl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 87950372 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | tert-butyl 2-methylidene-4-phenylbut-3-enoate;butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate |
| SMILES | C=C(C=Cc1ccccc1)C(=O)OC(C)(C)C.C=CC(=O)OCCCC.C=CC(=O)OCCO |
| InChI | InChI=1S/C15H18O2.C7H12O2.C5H8O3/c1-12(14(16)17-15(2,3)4)10-11-13-8-6-5-7-9-13;1-3-5-6-9-7(8)4-2;1-2-5(7)8-4-3-6/h5-11H,1H2,2-4H3;4H,2-3,5-6H2,1H3;2,6H,1,3-4H2 |
| InChIKey | QFCRULKKUMTSLT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|