C23H26O3 — CID 87493330
tert-butyl 2-methylidene-4-phenylbut-3-enoate;4-ethenylphenol (PubChem CID 87493330) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 2-methylidene-4-phenylbut-3-enoate;4-ethenylphenol.
| Compound Name | tert-butyl 2-methylidene-4-phenylbut-3-enoate;4-ethenylphenol |
|---|---|
| PubChem CID | 87493330 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | tert-butyl 2-methylidene-4-phenylbut-3-enoate;4-ethenylphenol |
| SMILES | C=C(C=Cc1ccccc1)C(=O)OC(C)(C)C.C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H18O2.C8H8O/c1-12(14(16)17-15(2,3)4)10-11-13-8-6-5-7-9-13;1-2-7-3-5-8(9)6-4-7/h5-11H,1H2,2-4H3;2-6,9H,1H2 |
| InChIKey | YBDMDDXODIDPSF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|