About 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene
5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene (PubChem CID 66955990) has the molecular formula C19H24O4
and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene.
Molecular Properties
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene |
| PubChem CID | 66955990 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene |
| SMILES | C=C(CC=CC(=O)O)C(=O)OC(C)(C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C11H16O4.C8H8/c1-8(6-5-7-9(12)13)10(14)15-11(2,3)4;1-2-8-6-4-3-5-7-8/h5,7H,1,6H2,2-4H3,(H,12,13);2-7H,1H2 |
| InChIKey | LIGKQUOVLQVYIT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene?
The IUPAC name of 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene (CID 66955990) is 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene.
What is the SMILES notation for 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene?
The canonical SMILES for 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene is C=C(CC=CC(=O)O)C(=O)OC(C)(C)C.C=Cc1ccccc1.
What is the InChIKey of 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene?
The InChIKey is LIGKQUOVLQVYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4.C8H8/c1-8(6-5-7-9(12)13)10(14)15-11(2,3)4;1-2-8-6-4-3-5-7-8/h5,7H,1,6H2,2-4H3,(H,12,13);2-7H,1H2.
What are the key properties of 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene?
5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene has a molecular weight of 316.40 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylpropan-2-yl)oxycarbonyl]hexa-2,5-dienoic acid;styrene is sourced from PubChem (CID 66955990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).