C33H40O6 — CID 158185481
tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;2-(2-ethoxyethoxy)ethenylbenzene (PubChem CID 158185481) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;2-(2-ethoxyethoxy)ethenylbenzene.
| Compound Name | tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;2-(2-ethoxyethoxy)ethenylbenzene |
|---|---|
| PubChem CID | 158185481 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;2-(2-ethoxyethoxy)ethenylbenzene |
| SMILES | C=Cc1ccc(O)cc1.C=Cc1ccc(OC(=O)OC(C)(C)C)cc1.CCOCCOC=Cc1ccccc1 |
| InChI | InChI=1S/C13H16O3.C12H16O2.C8H8O/c1-5-10-6-8-11(9-7-10)15-12(14)16-13(2,3)4;1-2-13-10-11-14-9-8-12-6-4-3-5-7-12;1-2-7-3-5-8(9)6-4-7/h5-9H,1H2,2-4H3;3-9H,2,10-11H2,1H3;2-6,9H,1H2 |
| InChIKey | FZBZIMKHHKLSEO-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|