C21H22O4 — CID 67428823
(4-ethenylphenyl) [1-[4-(2-hydroxyethenyl)phenyl]-2-methylpropan-2-yl] carbonate (PubChem CID 67428823) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (4-ethenylphenyl) [1-[4-(2-hydroxyethenyl)phenyl]-2-methylpropan-2-yl] carbonate.
| Compound Name | (4-ethenylphenyl) [1-[4-(2-hydroxyethenyl)phenyl]-2-methylpropan-2-yl] carbonate |
|---|---|
| PubChem CID | 67428823 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4-ethenylphenyl) [1-[4-(2-hydroxyethenyl)phenyl]-2-methylpropan-2-yl] carbonate |
| SMILES | C=Cc1ccc(OC(=O)OC(C)(C)Cc2ccc(C=CO)cc2)cc1 |
| InChI | InChI=1S/C21H22O4/c1-4-16-9-11-19(12-10-16)24-20(23)25-21(2,3)15-18-7-5-17(6-8-18)13-14-22/h4-14,22H,1,15H2,2-3H3 |
| InChIKey | CQUGFGYIQKTYFI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|