C34H38O6 — CID 87583294
[4-[4-[4-(1-ethoxy-1-methoxyethoxy)phenyl]buta-1,3-dienyl]phenyl] 3-[4-(2-hydroxyethenyl)phenyl]-2,2-dimethylpropanoate (PubChem CID 87583294) has the molecular formula C34H38O6 and a molecular weight of 542.67 g/mol. Its IUPAC name is [4-[4-[4-(1-ethoxy-1-methoxyethoxy)phenyl]buta-1,3-dienyl]phenyl] 3-[4-(2-hydroxyethenyl)phenyl]-2,2-dimethylpropanoate.
| Compound Name | [4-[4-[4-(1-ethoxy-1-methoxyethoxy)phenyl]buta-1,3-dienyl]phenyl] 3-[4-(2-hydroxyethenyl)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87583294 |
| Molecular Formula | C34H38O6 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [4-[4-[4-(1-ethoxy-1-methoxyethoxy)phenyl]buta-1,3-dienyl]phenyl] 3-[4-(2-hydroxyethenyl)phenyl]-2,2-dimethylpropanoate |
| SMILES | CCOC(C)(OC)Oc1ccc(C=CC=Cc2ccc(OC(=O)C(C)(C)Cc3ccc(C=CO)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H38O6/c1-6-38-34(4,37-5)40-31-21-17-27(18-22-31)10-8-7-9-26-15-19-30(20-16-26)39-32(36)33(2,3)25-29-13-11-28(12-14-29)23-24-35/h7-24,35H,6,25H2,1-5H3 |
| InChIKey | DLOIAUCTWMTTBU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|