C36H42O4 — CID 87583166
2-[4-[2-[4-[4-[4-(1-cyclohexyloxyethoxy)phenyl]buta-1,3-dienyl]phenoxy]-2-methylpropyl]phenyl]ethenol (PubChem CID 87583166) has the molecular formula C36H42O4 and a molecular weight of 538.73 g/mol. Its IUPAC name is 2-[4-[2-[4-[4-[4-(1-cyclohexyloxyethoxy)phenyl]buta-1,3-dienyl]phenoxy]-2-methylpropyl]phenyl]ethenol.
| Compound Name | 2-[4-[2-[4-[4-[4-(1-cyclohexyloxyethoxy)phenyl]buta-1,3-dienyl]phenoxy]-2-methylpropyl]phenyl]ethenol |
|---|---|
| PubChem CID | 87583166 |
| Molecular Formula | C36H42O4 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2-[4-[2-[4-[4-[4-(1-cyclohexyloxyethoxy)phenyl]buta-1,3-dienyl]phenoxy]-2-methylpropyl]phenyl]ethenol |
| SMILES | CC(Oc1ccc(C=CC=Cc2ccc(OC(C)(C)Cc3ccc(C=CO)cc3)cc2)cc1)OC1CCCCC1 |
| InChI | InChI=1S/C36H42O4/c1-28(38-33-11-5-4-6-12-33)39-34-21-17-29(18-22-34)9-7-8-10-30-19-23-35(24-20-30)40-36(2,3)27-32-15-13-31(14-16-32)25-26-37/h7-10,13-26,28,33,37H,4-6,11-12,27H2,1-3H3 |
| InChIKey | FKQRDVDGHZGHKC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|