C19H20O4 — CID 176886436
methyl 3-[4-(4-formylphenoxy)phenyl]-2,2-dimethylpropanoate (PubChem CID 176886436) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 3-[4-(4-formylphenoxy)phenyl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[4-(4-formylphenoxy)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176886436 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl 3-[4-(4-formylphenoxy)phenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1ccc(Oc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C19H20O4/c1-19(2,18(21)22-3)12-14-4-8-16(9-5-14)23-17-10-6-15(13-20)7-11-17/h4-11,13H,12H2,1-3H3 |
| InChIKey | CTDGWXDLGPGYIP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|