About methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride
methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride (PubChem CID 86742825) has the molecular formula C16H15ClI3NO4
and a molecular weight of 701.46 g/mol. Its IUPAC name is methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride |
| PubChem CID | 86742825 |
| Molecular Formula | C16H15ClI3NO4 |
| Molecular Weight | 701.46 g/mol |
| Exact Mass | 700.78 |
| IUPAC Name | methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride |
| SMILES | COC(=O)[C@](I)(Cc1ccc(Oc2ccc(O)cc2)cc1)N(I)I.Cl |
| InChI | InChI=1S/C16H14I3NO4.ClH/c1-23-15(22)16(17,20(18)19)10-11-2-6-13(7-3-11)24-14-8-4-12(21)5-9-14;/h2-9,21H,10H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | MQFZCGQXTUVNGD-NTISSMGPSA-N |
| XLogP | 5.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 701.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride?
The IUPAC name of methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride (CID 86742825) is methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride.
What is the SMILES notation for methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride?
The canonical SMILES for methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride is COC(=O)[C@](I)(Cc1ccc(Oc2ccc(O)cc2)cc1)N(I)I.Cl.
What is the InChIKey of methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride?
The InChIKey is MQFZCGQXTUVNGD-NTISSMGPSA-N. The full InChI is InChI=1S/C16H14I3NO4.ClH/c1-23-15(22)16(17,20(18)19)10-11-2-6-13(7-3-11)24-14-8-4-12(21)5-9-14;/h2-9,21H,10H2,1H3;1H/t16-;/m0./s1.
What are the key properties of methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride?
methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride has a molecular weight of 701.46 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(diiodoamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-iodopropanoate;hydrochloride is sourced from PubChem (CID 86742825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).