C25H23I2NO7 — CID 123789102
ethyl (2S)-2-[[1-(4-hydroxyphenoxy)-1,2-diiodo-2-oxoethyl]amino]-3-[4-(4-hydroxyphenoxy)phenyl]propanoate (PubChem CID 123789102) has the molecular formula C25H23I2NO7 and a molecular weight of 703.27 g/mol. Its IUPAC name is ethyl (2S)-2-[[1-(4-hydroxyphenoxy)-1,2-diiodo-2-oxoethyl]amino]-3-[4-(4-hydroxyphenoxy)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[[1-(4-hydroxyphenoxy)-1,2-diiodo-2-oxoethyl]amino]-3-[4-(4-hydroxyphenoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 123789102 |
| Molecular Formula | C25H23I2NO7 |
| Molecular Weight | 703.27 g/mol |
| Exact Mass | 702.96 |
| IUPAC Name | ethyl (2S)-2-[[1-(4-hydroxyphenoxy)-1,2-diiodo-2-oxoethyl]amino]-3-[4-(4-hydroxyphenoxy)phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(Oc2ccc(O)cc2)cc1)NC(I)(Oc1ccc(O)cc1)C(=O)I |
| InChI | InChI=1S/C25H23I2NO7/c1-2-33-23(31)22(28-25(27,24(26)32)35-21-13-7-18(30)8-14-21)15-16-3-9-19(10-4-16)34-20-11-5-17(29)6-12-20/h3-14,22,28-30H,2,15H2,1H3/t22-,25?/m0/s1 |
| InChIKey | GZGLULSFRKZCGU-XADRRFQNSA-N |
| XLogP | 5.08 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|