C14H20NO3Y- — CID 147443623
methyl 3-(4-ethoxyphenyl)-2-methyl-2-(methylamino)propanoate;yttrium (PubChem CID 147443623) has the molecular formula C14H20NO3Y- and a molecular weight of 339.22 g/mol. Its IUPAC name is methyl 3-(4-ethoxyphenyl)-2-methyl-2-(methylamino)propanoate;yttrium.
| Compound Name | methyl 3-(4-ethoxyphenyl)-2-methyl-2-(methylamino)propanoate;yttrium |
|---|---|
| PubChem CID | 147443623 |
| Molecular Formula | C14H20NO3Y- |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl 3-(4-ethoxyphenyl)-2-methyl-2-(methylamino)propanoate;yttrium |
| SMILES | [CH2-]COc1ccc(CC(C)(NC)C(=O)OC)cc1.[Y] |
| InChI | InChI=1S/C14H20NO3.Y/c1-5-18-12-8-6-11(7-9-12)10-14(2,15-3)13(16)17-4;/h6-9,15H,1,5,10H2,2-4H3;/q-1; |
| InChIKey | HPTQUIBAWVIPOT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|