C13H17NO5 — CID 102312983
dimethyl (2S)-2-amino-2-[(4-hydroxyphenyl)methyl]butanedioate (PubChem CID 102312983) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is dimethyl (2S)-2-amino-2-[(4-hydroxyphenyl)methyl]butanedioate.
| Compound Name | dimethyl (2S)-2-amino-2-[(4-hydroxyphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 102312983 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | dimethyl (2S)-2-amino-2-[(4-hydroxyphenyl)methyl]butanedioate |
| SMILES | COC(=O)C[C@@](N)(Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C13H17NO5/c1-18-11(16)8-13(14,12(17)19-2)7-9-3-5-10(15)6-4-9/h3-6,15H,7-8,14H2,1-2H3/t13-/m0/s1 |
| InChIKey | RBRWRBSFDHBITN-ZDUSSCGKSA-N |
| XLogP | 0.37 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |