C11H15NO3 — CID 69408244
2-amino-2-[(4-hydroxyphenyl)methyl]butanoic acid (PubChem CID 69408244) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-amino-2-[(4-hydroxyphenyl)methyl]butanoic acid.
| Compound Name | 2-amino-2-[(4-hydroxyphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 69408244 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-2-[(4-hydroxyphenyl)methyl]butanoic acid |
| SMILES | CCC(N)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-2-11(12,10(14)15)7-8-3-5-9(13)6-4-8/h3-6,13H,2,7,12H2,1H3,(H,14,15) |
| InChIKey | KEFQVZYLTYLBRA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |