C11H14FNO4 — CID 10354414
(2R)-2-amino-2-[(4-fluoro-2,3-dihydroxyphenyl)methyl]butanoic acid (PubChem CID 10354414) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is (2R)-2-amino-2-[(4-fluoro-2,3-dihydroxyphenyl)methyl]butanoic acid.
| Compound Name | (2R)-2-amino-2-[(4-fluoro-2,3-dihydroxyphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 10354414 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2R)-2-amino-2-[(4-fluoro-2,3-dihydroxyphenyl)methyl]butanoic acid |
| SMILES | CC[C@@](N)(Cc1ccc(F)c(O)c1O)C(=O)O |
| InChI | InChI=1S/C11H14FNO4/c1-2-11(13,10(16)17)5-6-3-4-7(12)9(15)8(6)14/h3-4,14-15H,2,5,13H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | HAZIHSACKNFFOM-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|