C17H18O6 — CID 159047656
2-(4-hydroxyphenyl)acetic acid;methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 159047656) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)acetic acid;methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | 2-(4-hydroxyphenyl)acetic acid;methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 159047656 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(4-hydroxyphenyl)acetic acid;methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | COC(=O)Cc1ccc(O)cc1.O=C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O3.C8H8O3/c1-12-9(11)6-7-2-4-8(10)5-3-7;9-7-3-1-6(2-4-7)5-8(10)11/h2-5,10H,6H2,1H3;1-4,9H,5H2,(H,10,11) |
| InChIKey | JWVXZHQDGSDSGX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |