C19H21ClO9 — CID 160505417
acetyl chloride;2-(3,4-dihydroxyphenyl)acetic acid;methyl 2-(3,4-dihydroxyphenyl)acetate (PubChem CID 160505417) has the molecular formula C19H21ClO9 and a molecular weight of 428.82 g/mol. Its IUPAC name is acetyl chloride;2-(3,4-dihydroxyphenyl)acetic acid;methyl 2-(3,4-dihydroxyphenyl)acetate.
| Compound Name | acetyl chloride;2-(3,4-dihydroxyphenyl)acetic acid;methyl 2-(3,4-dihydroxyphenyl)acetate |
|---|---|
| PubChem CID | 160505417 |
| Molecular Formula | C19H21ClO9 |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | acetyl chloride;2-(3,4-dihydroxyphenyl)acetic acid;methyl 2-(3,4-dihydroxyphenyl)acetate |
| SMILES | CC(=O)Cl.COC(=O)Cc1ccc(O)c(O)c1.O=C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O4.C8H8O4.C2H3ClO/c1-13-9(12)5-6-2-3-7(10)8(11)4-6;9-6-2-1-5(3-7(6)10)4-8(11)12;1-2(3)4/h2-4,10-11H,5H2,1H3;1-3,9-10H,4H2,(H,11,12);1H3 |
| InChIKey | QSIGXGWGWMRPKV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|